C14H11ClFNO — CID 2597668
N-[(4-chlorophenyl)methyl]-4-fluorobenzamide (PubChem CID 2597668) has the molecular formula C14H11ClFNO and a molecular weight of 263.70 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-fluorobenzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 2597668 |
| Molecular Formula | C14H11ClFNO |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-fluorobenzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11ClFNO/c15-12-5-1-10(2-6-12)9-17-14(18)11-3-7-13(16)8-4-11/h1-8H,9H2,(H,17,18) |
| InChIKey | OKYFYJDSWFOFRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |