C24H26FN3O2 — CID 26001788
N-[(2S)-1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-4-fluorobenzamide (PubChem CID 26001788) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[(2S)-1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 26001788 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(2S)-1-(cyclohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-4-fluorobenzamide |
| SMILES | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN3O2/c25-18-12-10-16(11-13-18)23(29)28-22(24(30)27-19-6-2-1-3-7-19)14-17-15-26-21-9-5-4-8-20(17)21/h4-5,8-13,15,19,22,26H,1-3,6-7,14H2,(H,27,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | KEYNOUIKAOWXLR-QFIPXVFZSA-N |
| XLogP | 4.10 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |