About 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide
2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 26002848) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 26002848 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | CC(C)c1cc(NC(=O)CN2CCNC(=O)C2)on1 |
| InChI | InChI=1S/C12H18N4O3/c1-8(2)9-5-12(19-15-9)14-11(18)7-16-4-3-13-10(17)6-16/h5,8H,3-4,6-7H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | LHJUZQOJAORCKD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (CID 26002848) is 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is CC(C)c1cc(NC(=O)CN2CCNC(=O)C2)on1.
What is the InChIKey of 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The InChIKey is LHJUZQOJAORCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3/c1-8(2)9-5-12(19-15-9)14-11(18)7-16-4-3-13-10(17)6-16/h5,8H,3-4,6-7H2,1-2H3,(H,13,17)(H,14,18).
What are the key properties of 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide has a molecular weight of 266.30 g/mol, XLogP of 0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxopiperazin-1-yl)-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 26002848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).