C24H28FN3O2 — CID 26005418
3-[[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 26005418) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 26005418 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-[[[(R)-(4-fluorophenyl)-phenylmethyl]-methylamino]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | CN(CN1C(=O)NC2(CCCCCC2)C1=O)[C@H](c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN3O2/c1-27(17-28-22(29)24(26-23(28)30)15-7-2-3-8-16-24)21(18-9-5-4-6-10-18)19-11-13-20(25)14-12-19/h4-6,9-14,21H,2-3,7-8,15-17H2,1H3,(H,26,30)/t21-/m1/s1 |
| InChIKey | SKEDAISGZBGMIE-OAQYLSRUSA-N |
| XLogP | 4.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|