C17H18F3NO4 — CID 26006935
(3R)-4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxy-N-(3-phenoxypropyl)butanamide (PubChem CID 26006935) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxy-N-(3-phenoxypropyl)butanamide.
| Compound Name | (3R)-4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxy-N-(3-phenoxypropyl)butanamide |
|---|---|
| PubChem CID | 26006935 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxy-N-(3-phenoxypropyl)butanamide |
| SMILES | O=C(C[C@@](O)(c1ccco1)C(F)(F)F)NCCCOc1ccccc1 |
| InChI | InChI=1S/C17H18F3NO4/c18-17(19,20)16(23,14-8-4-10-25-14)12-15(22)21-9-5-11-24-13-6-2-1-3-7-13/h1-4,6-8,10,23H,5,9,11-12H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | PCROJWVEJNTWQZ-MRXNPFEDSA-N |
| XLogP | 3.00 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|