C22H30N4O3 — CID 26010587
(3R)-2-[[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 26010587) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is (3R)-2-[[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-[[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 26010587 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (3R)-2-[[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN1Cc3ccccc3C[C@@H]1C(N)=O)C2=O |
| InChI | InChI=1S/C22H30N4O3/c1-14-9-21(2,3)12-22(10-14)19(28)26(20(29)24-22)13-25-11-16-7-5-4-6-15(16)8-17(25)18(23)27/h4-7,14,17H,8-13H2,1-3H3,(H2,23,27)(H,24,29)/t14-,17-,22-/m1/s1 |
| InChIKey | XKIHZHKJOJDMOT-UZSYQUHHSA-N |
| XLogP | 1.99 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|