C25H26N6O3S — CID 26011641
[2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate (PubChem CID 26011641) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate.
| Compound Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 26011641 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [2-[hexyl-(4-phenyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate |
| SMILES | CCCCCCN(C(=O)COC(=O)c1ccc(-n2cncn2)nc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C25H26N6O3S/c1-2-3-4-8-13-30(25-29-21(16-35-25)19-9-6-5-7-10-19)23(32)15-34-24(33)20-11-12-22(27-14-20)31-18-26-17-28-31/h5-7,9-12,14,16-18H,2-4,8,13,15H2,1H3 |
| InChIKey | VWMSFXWKLSLDPG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|