C20H21ClN4O2 — CID 26014846
1-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one (PubChem CID 26014846) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one.
| Compound Name | 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 26014846 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(CC(=O)N2CCN(c3ccccc3Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H21ClN4O2/c1-22-17-8-4-5-9-18(17)25(20(22)27)14-19(26)24-12-10-23(11-13-24)16-7-3-2-6-15(16)21/h2-9H,10-14H2,1H3 |
| InChIKey | NYVFYCYOOBSJRT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |