C24H26FN3O3S2 — CID 2602171
2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanyl-3-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2602171) has the molecular formula C24H26FN3O3S2 and a molecular weight of 487.62 g/mol. Its IUPAC name is 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanyl-3-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanyl-3-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2602171 |
| Molecular Formula | C24H26FN3O3S2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanyl-3-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CN(C(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccccc2F)CCCC4)C[C@H](C)O1 |
| InChI | InChI=1S/C24H26FN3O3S2/c1-14-11-27(12-15(2)31-14)20(29)13-32-24-26-22-21(16-7-3-6-10-19(16)33-22)23(30)28(24)18-9-5-4-8-17(18)25/h4-5,8-9,14-15H,3,6-7,10-13H2,1-2H3/t14-,15+ |
| InChIKey | KGZWIBBCOVPALN-GASCZTMLSA-N |
| XLogP | 4.19 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |