C4H8N6 — CID 26029
2-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 26029) has the molecular formula C4H8N6 and a molecular weight of 140.15 g/mol. Its IUPAC name is 2-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 26029 |
| Molecular Formula | C4H8N6 |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H8N6/c1-7-4-9-2(5)8-3(6)10-4/h1H3,(H5,5,6,7,8,9,10) |
| InChIKey | CTRPRMNBTVRDFH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |