C19H30N4OS — CID 2603096
N-cyclohexyl-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2603096) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2603096 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-cyclohexyl-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCCCC2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C19H30N4OS/c1-2-13-23-18(15-9-5-3-6-10-15)21-22-19(23)25-14-17(24)20-16-11-7-4-8-12-16/h2,15-16H,1,3-14H2,(H,20,24) |
| InChIKey | BKBNDWGALWKJLG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|