C18H17F3N2O4 — CID 26035709
1-[3-nitro-4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]phenyl]ethanone (PubChem CID 26035709) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 1-[3-nitro-4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]phenyl]ethanone |
|---|---|
| PubChem CID | 26035709 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[3-nitro-4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(NCc2ccc(COCC(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17F3N2O4/c1-12(24)15-6-7-16(17(8-15)23(25)26)22-9-13-2-4-14(5-3-13)10-27-11-18(19,20)21/h2-8,22H,9-11H2,1H3 |
| InChIKey | VRHYOAQBXCJFFJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|