About N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide
N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide (PubChem CID 26040319) has the molecular formula C16H14N4OS
and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide |
| PubChem CID | 26040319 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(Nc2ncnc3sccc23)cc1)C1CC1 |
| InChI | InChI=1S/C16H14N4OS/c21-15(10-1-2-10)20-12-5-3-11(4-6-12)19-14-13-7-8-22-16(13)18-9-17-14/h3-10H,1-2H2,(H,20,21)(H,17,18,19) |
| InChIKey | YWVSIUIGSGZFAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide?
The IUPAC name of N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide (CID 26040319) is N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide?
The canonical SMILES for N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide is O=C(Nc1ccc(Nc2ncnc3sccc23)cc1)C1CC1.
What is the InChIKey of N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide?
The InChIKey is YWVSIUIGSGZFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4OS/c21-15(10-1-2-10)20-12-5-3-11(4-6-12)19-14-13-7-8-22-16(13)18-9-17-14/h3-10H,1-2H2,(H,20,21)(H,17,18,19).
What are the key properties of N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide?
N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide has a molecular weight of 310.38 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]cyclopropanecarboxamide is sourced from PubChem (CID 26040319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).