About 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione
3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 26056219) has the molecular formula C20H25N5O4
and a molecular weight of 399.45 g/mol. Its IUPAC name is 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione.
Molecular Properties
| Compound Name | 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione |
| PubChem CID | 26056219 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | CCCCn1cnc2c1c(=O)n(Cc1cccc([N+](=O)[O-])c1)c(=O)n2CCCC |
| InChI | InChI=1S/C20H25N5O4/c1-3-5-10-22-14-21-18-17(22)19(26)24(20(27)23(18)11-6-4-2)13-15-8-7-9-16(12-15)25(28)29/h7-9,12,14H,3-6,10-11,13H2,1-2H3 |
| InChIKey | ZPGQXFIHRADWFC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione?
The IUPAC name of 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione (CID 26056219) is 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione.
What is the SMILES notation for 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione?
The canonical SMILES for 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione is CCCCn1cnc2c1c(=O)n(Cc1cccc([N+](=O)[O-])c1)c(=O)n2CCCC.
What is the InChIKey of 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione?
The InChIKey is ZPGQXFIHRADWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O4/c1-3-5-10-22-14-21-18-17(22)19(26)24(20(27)23(18)11-6-4-2)13-15-8-7-9-16(12-15)25(28)29/h7-9,12,14H,3-6,10-11,13H2,1-2H3.
What are the key properties of 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione?
3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione has a molecular weight of 399.45 g/mol, XLogP of 2.92, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dibutyl-1-[(3-nitrophenyl)methyl]purine-2,6-dione is sourced from PubChem (CID 26056219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).