C24H27ClN4O5 — CID 26058794
N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethoxy]benzamide (PubChem CID 26058794) has the molecular formula C24H27ClN4O5 and a molecular weight of 486.96 g/mol. Its IUPAC name is N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethoxy]benzamide.
| Compound Name | N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 26058794 |
| Molecular Formula | C24H27ClN4O5 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethoxy]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(OCC(=O)N2[C@@H](C)CCC[C@@H]2C)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27ClN4O5/c1-15-5-4-6-16(2)28(15)23(30)14-34-20-10-7-18(8-11-20)24(31)27-26-17(3)19-9-12-21(25)22(13-19)29(32)33/h7-13,15-16H,4-6,14H2,1-3H3,(H,27,31)/b26-17-/t15-,16-/m0/s1 |
| InChIKey | WCJMUVUCJCALNO-SUEICXKMSA-N |
| XLogP | 4.57 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|