C19H15FN3O4- — CID 2608298
3-[2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxylate (PubChem CID 2608298) has the molecular formula C19H15FN3O4- and a molecular weight of 368.34 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxylate.
| Compound Name | 3-[2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2608298 |
| Molecular Formula | C19H15FN3O4- |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxylate |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)Cn1nc(C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C19H16FN3O4/c1-22(10-12-6-8-13(20)9-7-12)16(24)11-23-18(25)15-5-3-2-4-14(15)17(21-23)19(26)27/h2-9H,10-11H2,1H3,(H,26,27)/p-1 |
| InChIKey | BDFCXRSCEZBDQI-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |