C18H21ClN2O3S — CID 26085188
2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide (PubChem CID 26085188) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 26085188 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1[C@H](C)NC(=O)CN(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-13-6-4-5-7-17(13)14(2)20-18(22)12-21(3)25(23,24)16-10-8-15(19)9-11-16/h4-11,14H,12H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | LINIDMDVEFCMBQ-AWEZNQCLSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |