C18H20N4O — CID 26085870
1-ethyl-N-(2,4,6-trimethylphenyl)benzotriazole-5-carboxamide (PubChem CID 26085870) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-ethyl-N-(2,4,6-trimethylphenyl)benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-(2,4,6-trimethylphenyl)benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 26085870 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-ethyl-N-(2,4,6-trimethylphenyl)benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)Nc3c(C)cc(C)cc3C)ccc21 |
| InChI | InChI=1S/C18H20N4O/c1-5-22-16-7-6-14(10-15(16)20-21-22)18(23)19-17-12(3)8-11(2)9-13(17)4/h6-10H,5H2,1-4H3,(H,19,23) |
| InChIKey | HLINRDZTNXVZMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |