2-(2,2-dimethylpropanoylamino)acetic acid

C7H13NO3 — CID 2608784

IUPAC2-(2,2-dimethylpropanoylamino)acetic acid
SMILESCC(C)(C)C(=O)NCC(=O)O
InChIInChI=1S/C7H13NO3/c1-7(2,3)6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10)
InChIKeyRTRUEBYROMJFNU-UHFFFAOYSA-N
MW159.18 g/mol
LogP0.23
Rot. Bonds2

About 2-(2,2-dimethylpropanoylamino)acetic acid

2-(2,2-dimethylpropanoylamino)acetic acid (PubChem CID 2608784) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropanoylamino)acetic acid
PubChem CID2608784
Molecular FormulaC7H13NO3
Molecular Weight159.18 g/mol
Exact Mass159.09
IUPAC Name2-(2,2-dimethylpropanoylamino)acetic acid
SMILESCC(C)(C)C(=O)NCC(=O)O
InChIInChI=1S/C7H13NO3/c1-7(2,3)6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10)
InChIKeyRTRUEBYROMJFNU-UHFFFAOYSA-N
XLogP0.23
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.18
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-dimethylpropanoylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)acetic acid?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)acetic acid (CID 2608784) is 2-(2,2-dimethylpropanoylamino)acetic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)acetic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)acetic acid is CC(C)(C)C(=O)NCC(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)acetic acid?
The InChIKey is RTRUEBYROMJFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(2,3)6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10).
What are the key properties of 2-(2,2-dimethylpropanoylamino)acetic acid?
2-(2,2-dimethylpropanoylamino)acetic acid has a molecular weight of 159.18 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)acetic acid is sourced from PubChem (CID 2608784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).