C21H18O7 — CID 26087917
(1R,6R,13R)-6-(3-hydroxyprop-1-en-2-yl)-7,11,17,19,23-pentaoxahexacyclo[11.10.0.02,10.04,8.014,22.016,20]tricosa-2(10),3,8,14,16(20),21-hexaen-13-ol (PubChem CID 26087917) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is (1R,6R,13R)-6-(3-hydroxyprop-1-en-2-yl)-7,11,17,19,23-pentaoxahexacyclo[11.10.0.02,10.04,8.014,22.016,20]tricosa-2(10),3,8,14,16(20),21-hexaen-13-ol.
| Compound Name | (1R,6R,13R)-6-(3-hydroxyprop-1-en-2-yl)-7,11,17,19,23-pentaoxahexacyclo[11.10.0.02,10.04,8.014,22.016,20]tricosa-2(10),3,8,14,16(20),21-hexaen-13-ol |
|---|---|
| PubChem CID | 26087917 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (1R,6R,13R)-6-(3-hydroxyprop-1-en-2-yl)-7,11,17,19,23-pentaoxahexacyclo[11.10.0.02,10.04,8.014,22.016,20]tricosa-2(10),3,8,14,16(20),21-hexaen-13-ol |
| SMILES | C=C(CO)[C@H]1Cc2cc3c(cc2O1)OC[C@]1(O)c2cc4c(cc2O[C@H]31)OCO4 |
| InChI | InChI=1S/C21H18O7/c1-10(7-22)14-3-11-2-12-16(5-15(11)27-14)24-8-21(23)13-4-18-19(26-9-25-18)6-17(13)28-20(12)21/h2,4-6,14,20,22-23H,1,3,7-9H2/t14-,20-,21+/m1/s1 |
| InChIKey | DJHQWCYVXKGRAS-IFZYUDKTSA-N |
| XLogP | 1.98 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|