C18H17BrF3N3O2 — CID 2609006
2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 2609006) has the molecular formula C18H17BrF3N3O2 and a molecular weight of 444.25 g/mol. Its IUPAC name is 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2609006 |
| Molecular Formula | C18H17BrF3N3O2 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17BrF3N3O2/c1-25(11-17(27)24-15-9-5-3-7-13(15)19)10-16(26)23-14-8-4-2-6-12(14)18(20,21)22/h2-9H,10-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | PIYZZMYURWBXRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |