C25H23N3O3S — CID 2609752
(2S)-2-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide (PubChem CID 2609752) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is (2S)-2-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide.
| Compound Name | (2S)-2-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 2609752 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2S)-2-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide |
| SMILES | COc1ccc(C)cc1-n1c(S[C@@H](C)C(=O)Nc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H23N3O3S/c1-16-13-14-22(31-3)21(15-16)28-24(30)19-11-7-8-12-20(19)27-25(28)32-17(2)23(29)26-18-9-5-4-6-10-18/h4-15,17H,1-3H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | USEFNTPFGQUJTK-KRWDZBQOSA-N |
| XLogP | 4.82 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |