C21H23FN2O2 — CID 26110571
(4R)-7-fluoro-2-oxo-N-(4-pentylphenyl)-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 26110571) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (4R)-7-fluoro-2-oxo-N-(4-pentylphenyl)-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4R)-7-fluoro-2-oxo-N-(4-pentylphenyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26110571 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (4R)-7-fluoro-2-oxo-N-(4-pentylphenyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)[C@@H]2CC(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C21H23FN2O2/c1-2-3-4-5-14-6-9-16(10-7-14)23-21(26)18-13-20(25)24-19-12-15(22)8-11-17(18)19/h6-12,18H,2-5,13H2,1H3,(H,23,26)(H,24,25)/t18-/m1/s1 |
| InChIKey | LMDAHWGAPDLFEE-GOSISDBHSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|