C18H15Cl2N3O2S — CID 26116057
N-(1,3-benzothiazol-2-yl)-3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyridine-2-carboxamide (PubChem CID 26116057) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26116057 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N(C[C@@H]1CCCO1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c19-12-7-8-15(20)22-16(12)17(24)23(10-11-4-3-9-25-11)18-21-13-5-1-2-6-14(13)26-18/h1-2,5-8,11H,3-4,9-10H2/t11-/m0/s1 |
| InChIKey | JMDKODPPSOREDF-NSHDSACASA-N |
| XLogP | 4.82 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|