About 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol
3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol (PubChem CID 26123) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol.
Analyze 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol?
The IUPAC name of 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol (CID 26123) is 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol.
What is the SMILES notation for 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol?
The canonical SMILES for 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol is CN(C)C1C(C)(C)C(O)C1(C)C.
What is the InChIKey of 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol?
The InChIKey is CFSSULJRBHLDFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-9(2)7(11(5)6)10(3,4)8(9)12/h7-8,12H,1-6H3.
What are the key properties of 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol?
3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol has a molecular weight of 171.28 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-2,2,4,4-tetramethylcyclobutan-1-ol is sourced from PubChem (CID 26123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).