C17H21ClN2O4S — CID 2612967
[2-(4-chloroanilino)-2-oxoethyl] 2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetate (PubChem CID 2612967) has the molecular formula C17H21ClN2O4S and a molecular weight of 384.89 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetate |
|---|---|
| PubChem CID | 2612967 |
| Molecular Formula | C17H21ClN2O4S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSCC(=O)N1CCCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S/c18-13-4-6-14(7-5-13)19-15(21)10-24-17(23)12-25-11-16(22)20-8-2-1-3-9-20/h4-7H,1-3,8-12H2,(H,19,21) |
| InChIKey | FTUXZKJWMXIRTQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |