C22H31N5O3 — CID 26134300
2-[1-ethyl-8-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 26134300) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[1-ethyl-8-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | 2-[1-ethyl-8-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 26134300 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[1-ethyl-8-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCN1C(=O)N(CC(N)=O)C(=O)C12CCN(Cc1ccc3c(c1)CCCN3C)CC2 |
| InChI | InChI=1S/C22H31N5O3/c1-3-27-21(30)26(15-19(23)28)20(29)22(27)8-11-25(12-9-22)14-16-6-7-18-17(13-16)5-4-10-24(18)2/h6-7,13H,3-5,8-12,14-15H2,1-2H3,(H2,23,28) |
| InChIKey | VHECUGSZSKAZNU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|