C20H31N3O3 — CID 26135023
8-(furan-3-ylmethyl)-1-(3-methylbutyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26135023) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 8-(furan-3-ylmethyl)-1-(3-methylbutyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(furan-3-ylmethyl)-1-(3-methylbutyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26135023 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 8-(furan-3-ylmethyl)-1-(3-methylbutyl)-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CCN1C(=O)N(C(C)C)C(=O)C12CCN(Cc1ccoc1)CC2 |
| InChI | InChI=1S/C20H31N3O3/c1-15(2)5-9-22-19(25)23(16(3)4)18(24)20(22)7-10-21(11-8-20)13-17-6-12-26-14-17/h6,12,14-16H,5,7-11,13H2,1-4H3 |
| InChIKey | KBCSPPRXKGCBBL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|