C25H30N4O2 — CID 26135389
1-methyl-8-[(E)-3-phenylprop-2-enyl]-3-(3-pyridin-4-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26135389) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-methyl-8-[(E)-3-phenylprop-2-enyl]-3-(3-pyridin-4-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-methyl-8-[(E)-3-phenylprop-2-enyl]-3-(3-pyridin-4-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26135389 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-methyl-8-[(E)-3-phenylprop-2-enyl]-3-(3-pyridin-4-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(CCCc2ccncc2)C(=O)C12CCN(C/C=C/c1ccccc1)CC2 |
| InChI | InChI=1S/C25H30N4O2/c1-27-24(31)29(18-6-10-22-11-15-26-16-12-22)23(30)25(27)13-19-28(20-14-25)17-5-9-21-7-3-2-4-8-21/h2-5,7-9,11-12,15-16H,6,10,13-14,17-20H2,1H3/b9-5+ |
| InChIKey | QNBOYDKRSFWPRL-WEVVVXLNSA-N |
| XLogP | 3.46 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|