C24H24N4O4 — CID 26136738
(6S)-1-benzyl-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one (PubChem CID 26136738) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (6S)-1-benzyl-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one.
| Compound Name | (6S)-1-benzyl-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 26136738 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (6S)-1-benzyl-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2cc[n+]([O-])cc2)C[C@H](OCc2cccnc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O4/c29-23-17-27(24(30)21-8-11-28(31)12-9-21)16-22(32-18-20-7-4-10-25-13-20)15-26(23)14-19-5-2-1-3-6-19/h1-13,22H,14-18H2/t22-/m1/s1 |
| InChIKey | PNPHHMFDPDUYOR-JOCHJYFZSA-N |
| XLogP | 1.78 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|