C24H24F2N4O — CID 26138086
N-benzyl-5-[(3,4-difluorophenyl)methyl]-1-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 26138086) has the molecular formula C24H24F2N4O and a molecular weight of 422.48 g/mol. Its IUPAC name is N-benzyl-5-[(3,4-difluorophenyl)methyl]-1-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N-benzyl-5-[(3,4-difluorophenyl)methyl]-1-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26138086 |
| Molecular Formula | C24H24F2N4O |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-benzyl-5-[(3,4-difluorophenyl)methyl]-1-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | C=CCn1nc(C(=O)NCc2ccccc2)c2c1CCN(Cc1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C24H24F2N4O/c1-2-11-30-22-10-12-29(15-18-8-9-20(25)21(26)13-18)16-19(22)23(28-30)24(31)27-14-17-6-4-3-5-7-17/h2-9,13H,1,10-12,14-16H2,(H,27,31) |
| InChIKey | DJSLAJHLXADMKA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|