C28H37N5O2 — CID 26142712
3-[2-(dimethylamino)ethyl]-1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26142712) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26142712 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(CCN(C)C)C(=O)C12CCN(Cc1ccc3c(c1)c1ccccc1n3CC)CC2 |
| InChI | InChI=1S/C28H37N5O2/c1-5-31-24-10-8-7-9-22(24)23-19-21(11-12-25(23)31)20-30-15-13-28(14-16-30)26(34)32(18-17-29(3)4)27(35)33(28)6-2/h7-12,19H,5-6,13-18,20H2,1-4H3 |
| InChIKey | MJAGWNAOHXBBIL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|