C32H35N5O2 — CID 26144982
1-benzyl-8-[(1-methylindol-3-yl)methyl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26144982) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 1-benzyl-8-[(1-methylindol-3-yl)methyl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-[(1-methylindol-3-yl)methyl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26144982 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-benzyl-8-[(1-methylindol-3-yl)methyl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1cc(CN2CCC3(CC2)C(=O)N(CCCc2cccnc2)C(=O)N3Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H35N5O2/c1-34-23-27(28-13-5-6-14-29(28)34)24-35-19-15-32(16-20-35)30(38)36(18-8-12-25-11-7-17-33-21-25)31(39)37(32)22-26-9-3-2-4-10-26/h2-7,9-11,13-14,17,21,23H,8,12,15-16,18-20,22,24H2,1H3 |
| InChIKey | OPOPEKUJCPFDGQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|