C21H19NO9 — CID 2614581
dimethyl 5-[[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 2614581) has the molecular formula C21H19NO9 and a molecular weight of 429.38 g/mol. Its IUPAC name is dimethyl 5-[[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2614581 |
| Molecular Formula | C21H19NO9 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | dimethyl 5-[[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)[C@H]2COc3ccccc3O2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H19NO9/c1-27-19(24)12-7-13(20(25)28-2)9-14(8-12)22-18(23)11-30-21(26)17-10-29-15-5-3-4-6-16(15)31-17/h3-9,17H,10-11H2,1-2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | ZGPNSYYSKCJJRU-QGZVFWFLSA-N |
| XLogP | 1.58 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|