C24H29N3O3 — CID 26146714
(6S)-1-cyclohexyl-6-phenylmethoxy-4-(pyridine-4-carbonyl)-1,4-diazepan-2-one (PubChem CID 26146714) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is (6S)-1-cyclohexyl-6-phenylmethoxy-4-(pyridine-4-carbonyl)-1,4-diazepan-2-one.
| Compound Name | (6S)-1-cyclohexyl-6-phenylmethoxy-4-(pyridine-4-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 26146714 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (6S)-1-cyclohexyl-6-phenylmethoxy-4-(pyridine-4-carbonyl)-1,4-diazepan-2-one |
| SMILES | O=C(c1ccncc1)N1CC(=O)N(C2CCCCC2)C[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H29N3O3/c28-23-17-26(24(29)20-11-13-25-14-12-20)15-22(30-18-19-7-3-1-4-8-19)16-27(23)21-9-5-2-6-10-21/h1,3-4,7-8,11-14,21-22H,2,5-6,9-10,15-18H2/t22-/m0/s1 |
| InChIKey | YLSYVCZWUGACKI-QFIPXVFZSA-N |
| XLogP | 3.28 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |