C19H18ClNO8S — CID 2614722
dimethyl 5-[[2-(5-chloro-2-methoxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2614722) has the molecular formula C19H18ClNO8S and a molecular weight of 455.87 g/mol. Its IUPAC name is dimethyl 5-[[2-(5-chloro-2-methoxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(5-chloro-2-methoxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2614722 |
| Molecular Formula | C19H18ClNO8S |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | dimethyl 5-[[2-(5-chloro-2-methoxybenzoyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)COC(=O)c2cc(Cl)ccc2OC)c(C(=O)OC)c1C |
| InChI | InChI=1S/C19H18ClNO8S/c1-9-14(18(24)27-3)16(30-15(9)19(25)28-4)21-13(22)8-29-17(23)11-7-10(20)5-6-12(11)26-2/h5-7H,8H2,1-4H3,(H,21,22) |
| InChIKey | GVUDPJNMNCLRHI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|