C21H26N2O3 — CID 26162261
3-[(4-methoxybenzoyl)amino]-N,N-dipropylbenzamide (PubChem CID 26162261) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[(4-methoxybenzoyl)amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[(4-methoxybenzoyl)amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 26162261 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-[(4-methoxybenzoyl)amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(NC(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-13-23(14-5-2)21(25)17-7-6-8-18(15-17)22-20(24)16-9-11-19(26-3)12-10-16/h6-12,15H,4-5,13-14H2,1-3H3,(H,22,24) |
| InChIKey | OSGMYPAWIRBXLT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |