C22H25N3O4 — CID 26162561
3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N,N-dipropylbenzamide (PubChem CID 26162561) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 26162561 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-3-14-24(15-4-2)22(27)18-6-5-7-19(16-18)23-21(26)13-10-17-8-11-20(12-9-17)25(28)29/h5-13,16H,3-4,14-15H2,1-2H3,(H,23,26)/b13-10+ |
| InChIKey | RLTPBKFJUROWCQ-JLHYYAGUSA-N |
| XLogP | 4.51 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|