About [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 2616604) has the molecular formula C16H13F2NO3S
and a molecular weight of 337.35 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
| PubChem CID | 2616604 |
| Molecular Formula | C16H13F2NO3S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F2NO3S/c17-11-6-7-14(13(18)8-11)19-15(20)9-22-16(21)10-23-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,19,20) |
| InChIKey | GUIBWMNXXFZQAP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate?
The IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate (CID 2616604) is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate.
What is the SMILES notation for [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate?
The canonical SMILES for [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate is O=C(COC(=O)CSc1ccccc1)Nc1ccc(F)cc1F.
What is the InChIKey of [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate?
The InChIKey is GUIBWMNXXFZQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO3S/c17-11-6-7-14(13(18)8-11)19-15(20)9-22-16(21)10-23-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,19,20).
What are the key properties of [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate?
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate has a molecular weight of 337.35 g/mol, XLogP of 3.24, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylsulfanylacetate is sourced from PubChem (CID 2616604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).