About N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide
N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide (PubChem CID 26176511) has the molecular formula C18H15N3O3S2
and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide.
Molecular Properties
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide |
| PubChem CID | 26176511 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide |
| SMILES | Cc1csc(N(C(=O)CSc2ccc([N+](=O)[O-])cc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H15N3O3S2/c1-13-11-26-18(19-13)20(14-5-3-2-4-6-14)17(22)12-25-16-9-7-15(8-10-16)21(23)24/h2-11H,12H2,1H3 |
| InChIKey | PDAFDZJNVZETKB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide?
The IUPAC name of N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide (CID 26176511) is N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide.
What is the SMILES notation for N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide?
The canonical SMILES for N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide is Cc1csc(N(C(=O)CSc2ccc([N+](=O)[O-])cc2)c2ccccc2)n1.
What is the InChIKey of N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide?
The InChIKey is PDAFDZJNVZETKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3S2/c1-13-11-26-18(19-13)20(14-5-3-2-4-6-14)17(22)12-25-16-9-7-15(8-10-16)21(23)24/h2-11H,12H2,1H3.
What are the key properties of N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide?
N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide has a molecular weight of 385.47 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)sulfanyl-N-phenylacetamide is sourced from PubChem (CID 26176511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).