C20H24F2N2O4S — CID 26177148
N'-[2-(1-adamantyl)acetyl]-4-(difluoromethylsulfonyl)benzohydrazide (PubChem CID 26177148) has the molecular formula C20H24F2N2O4S and a molecular weight of 426.49 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-4-(difluoromethylsulfonyl)benzohydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-4-(difluoromethylsulfonyl)benzohydrazide |
|---|---|
| PubChem CID | 26177148 |
| Molecular Formula | C20H24F2N2O4S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-4-(difluoromethylsulfonyl)benzohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C20H24F2N2O4S/c21-19(22)29(27,28)16-3-1-15(2-4-16)18(26)24-23-17(25)11-20-8-12-5-13(9-20)7-14(6-12)10-20/h1-4,12-14,19H,5-11H2,(H,23,25)(H,24,26) |
| InChIKey | ZIHCLSNJRCZKRP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|