C17H16F3N5O3 — CID 26177639
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 26177639) has the molecular formula C17H16F3N5O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 26177639 |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1nc2nccc(C)n2n1 |
| InChI | InChI=1S/C17H16F3N5O3/c1-10-5-6-21-16-23-14(24-25(10)16)15(26)22-12-9-11(17(18,19)20)3-4-13(12)28-8-7-27-2/h3-6,9H,7-8H2,1-2H3,(H,22,26) |
| InChIKey | OORDUXSZJMOTDY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|