C23H23NO3S — CID 26177688
N-[(R)-(3,4-dimethylphenyl)-phenylmethyl]-4-methylsulfonylbenzamide (PubChem CID 26177688) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(R)-(3,4-dimethylphenyl)-phenylmethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(R)-(3,4-dimethylphenyl)-phenylmethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 26177688 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(R)-(3,4-dimethylphenyl)-phenylmethyl]-4-methylsulfonylbenzamide |
| SMILES | Cc1ccc([C@H](NC(=O)c2ccc(S(C)(=O)=O)cc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C23H23NO3S/c1-16-9-10-20(15-17(16)2)22(18-7-5-4-6-8-18)24-23(25)19-11-13-21(14-12-19)28(3,26)27/h4-15,22H,1-3H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | TUZJGHMVKLEOFG-JOCHJYFZSA-N |
| XLogP | 4.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |