C19H18ClN3O2 — CID 26179891
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-phenylmethoxybenzamide (PubChem CID 26179891) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-phenylmethoxybenzamide.
| Compound Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 26179891 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-phenylmethoxybenzamide |
| SMILES | Cc1nn(-c2ccc(C(=O)NOCc3ccccc3)cc2)c(C)c1Cl |
| InChI | InChI=1S/C19H18ClN3O2/c1-13-18(20)14(2)23(21-13)17-10-8-16(9-11-17)19(24)22-25-12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,22,24) |
| InChIKey | RPVCSNVWNJKTBD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|