C19H17N3 — CID 26182228
(7R)-2-methyl-3,7-diphenyl-6,7-dihydropyrazolo[1,5-a]pyrimidine (PubChem CID 26182228) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is (7R)-2-methyl-3,7-diphenyl-6,7-dihydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (7R)-2-methyl-3,7-diphenyl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 26182228 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (7R)-2-methyl-3,7-diphenyl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1nn2c(c1-c1ccccc1)N=CC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H17N3/c1-14-18(16-10-6-3-7-11-16)19-20-13-12-17(22(19)21-14)15-8-4-2-5-9-15/h2-11,13,17H,12H2,1H3/t17-/m1/s1 |
| InChIKey | WANWNMSQEXJSSZ-QGZVFWFLSA-N |
| XLogP | 4.55 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |