C18H21N3O3 — CID 26184762
3-(dimethylamino)-N'-[2-(4-methoxyphenyl)acetyl]benzohydrazide (PubChem CID 26184762) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-(dimethylamino)-N'-[2-(4-methoxyphenyl)acetyl]benzohydrazide.
| Compound Name | 3-(dimethylamino)-N'-[2-(4-methoxyphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26184762 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(dimethylamino)-N'-[2-(4-methoxyphenyl)acetyl]benzohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cccc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-21(2)15-6-4-5-14(12-15)18(23)20-19-17(22)11-13-7-9-16(24-3)10-8-13/h4-10,12H,11H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | LPXOJMZUVBWOOF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|