C22H18FN3O3S — CID 26187981
(4-acetamidophenyl) 1-[(4-fluorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 26187981) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol. Its IUPAC name is (4-acetamidophenyl) 1-[(4-fluorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (4-acetamidophenyl) 1-[(4-fluorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 26187981 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (4-acetamidophenyl) 1-[(4-fluorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2cc3c(C)nn(Cc4ccc(F)cc4)c3s2)cc1 |
| InChI | InChI=1S/C22H18FN3O3S/c1-13-19-11-20(22(28)29-18-9-7-17(8-10-18)24-14(2)27)30-21(19)26(25-13)12-15-3-5-16(23)6-4-15/h3-11H,12H2,1-2H3,(H,24,27) |
| InChIKey | XTKNHEHWUYBKAK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|