About 5-bromo-2-(2,4-difluorophenoxy)aniline
5-bromo-2-(2,4-difluorophenoxy)aniline (PubChem CID 26190500) has the molecular formula C12H8BrF2NO
and a molecular weight of 300.10 g/mol. Its IUPAC name is 5-bromo-2-(2,4-difluorophenoxy)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-(2,4-difluorophenoxy)aniline |
| PubChem CID | 26190500 |
| Molecular Formula | C12H8BrF2NO |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 5-bromo-2-(2,4-difluorophenoxy)aniline |
| SMILES | Nc1cc(Br)ccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H8BrF2NO/c13-7-1-3-12(10(16)5-7)17-11-4-2-8(14)6-9(11)15/h1-6H,16H2 |
| InChIKey | PVVVFOBRPYJBNM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(2,4-difluorophenoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2,4-difluorophenoxy)aniline?
The IUPAC name of 5-bromo-2-(2,4-difluorophenoxy)aniline (CID 26190500) is 5-bromo-2-(2,4-difluorophenoxy)aniline.
What is the SMILES notation for 5-bromo-2-(2,4-difluorophenoxy)aniline?
The canonical SMILES for 5-bromo-2-(2,4-difluorophenoxy)aniline is Nc1cc(Br)ccc1Oc1ccc(F)cc1F.
What is the InChIKey of 5-bromo-2-(2,4-difluorophenoxy)aniline?
The InChIKey is PVVVFOBRPYJBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrF2NO/c13-7-1-3-12(10(16)5-7)17-11-4-2-8(14)6-9(11)15/h1-6H,16H2.
What are the key properties of 5-bromo-2-(2,4-difluorophenoxy)aniline?
5-bromo-2-(2,4-difluorophenoxy)aniline has a molecular weight of 300.10 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2,4-difluorophenoxy)aniline is sourced from PubChem (CID 26190500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).