C15H21NO — CID 26191291
(3R)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)piperidine (PubChem CID 26191291) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3R)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)piperidine.
| Compound Name | (3R)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)piperidine |
|---|---|
| PubChem CID | 26191291 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3R)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)piperidine |
| SMILES | c1cc2c(c(O[C@@H]3CCCNC3)c1)CCCC2 |
| InChI | InChI=1S/C15H21NO/c1-2-8-14-12(5-1)6-3-9-15(14)17-13-7-4-10-16-11-13/h3,6,9,13,16H,1-2,4-5,7-8,10-11H2/t13-/m1/s1 |
| InChIKey | UCVXIUQDUQFZAS-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |