C11H13Cl2NO — CID 26191322
(3S)-3-(2,5-dichlorophenoxy)piperidine (PubChem CID 26191322) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is (3S)-3-(2,5-dichlorophenoxy)piperidine.
| Compound Name | (3S)-3-(2,5-dichlorophenoxy)piperidine |
|---|---|
| PubChem CID | 26191322 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (3S)-3-(2,5-dichlorophenoxy)piperidine |
| SMILES | Clc1ccc(Cl)c(O[C@H]2CCCNC2)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-8-3-4-10(13)11(6-8)15-9-2-1-5-14-7-9/h3-4,6,9,14H,1-2,5,7H2/t9-/m0/s1 |
| InChIKey | QMTVYKYQMXJBEC-VIFPVBQESA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |